C10H22N2O — CID 105209990
(5-methyl-1-propoxyhex-5-en-2-yl)hydrazine (PubChem CID 105209990) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (5-methyl-1-propoxyhex-5-en-2-yl)hydrazine.
| Compound Name | (5-methyl-1-propoxyhex-5-en-2-yl)hydrazine |
|---|---|
| PubChem CID | 105209990 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (5-methyl-1-propoxyhex-5-en-2-yl)hydrazine |
| SMILES | C=C(C)CCC(COCCC)NN |
| InChI | InChI=1S/C10H22N2O/c1-4-7-13-8-10(12-11)6-5-9(2)3/h10,12H,2,4-8,11H2,1,3H3 |
| InChIKey | GOEVOCGSKYIWIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|