C21H22O2S — CID 10521003
3,3-dibenzyl-5-ethylsulfanyl-4-methylfuran-2-one (PubChem CID 10521003) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is 3,3-dibenzyl-5-ethylsulfanyl-4-methylfuran-2-one.
| Compound Name | 3,3-dibenzyl-5-ethylsulfanyl-4-methylfuran-2-one |
|---|---|
| PubChem CID | 10521003 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3,3-dibenzyl-5-ethylsulfanyl-4-methylfuran-2-one |
| SMILES | CCSC1=C(C)C(Cc2ccccc2)(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C21H22O2S/c1-3-24-19-16(2)21(20(22)23-19,14-17-10-6-4-7-11-17)15-18-12-8-5-9-13-18/h4-13H,3,14-15H2,1-2H3 |
| InChIKey | XEBCHNCFWDHCRA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |