C18H34O4Si — CID 10521282
(4S,5S)-4-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-methylidene-5-pentyloxolan-2-one (PubChem CID 10521282) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (4S,5S)-4-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-methylidene-5-pentyloxolan-2-one.
| Compound Name | (4S,5S)-4-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-methylidene-5-pentyloxolan-2-one |
|---|---|
| PubChem CID | 10521282 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (4S,5S)-4-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-methylidene-5-pentyloxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](CCCCC)[C@@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-8-9-10-11-15-16(13(2)17(20)22-15)14(19)12-21-23(6,7)18(3,4)5/h14-16,19H,2,8-12H2,1,3-7H3/t14-,15+,16+/m1/s1 |
| InChIKey | XEFDUJQJDQFESX-PMPSAXMXSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|