C18H20O5S — CID 10521683
[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10521683) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is [(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10521683 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20O5S/c1-14-7-9-16(10-8-14)24(19,20)22-13-18-17(23-18)12-21-11-15-5-3-2-4-6-15/h2-10,17-18H,11-13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | BFDSNKKZNNGYAI-ROUUACIJSA-N |
| XLogP | 2.68 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|