C9H20N2 — CID 105219793
2,5-dimethylhept-2-en-4-ylhydrazine (PubChem CID 105219793) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 2,5-dimethylhept-2-en-4-ylhydrazine.
| Compound Name | 2,5-dimethylhept-2-en-4-ylhydrazine |
|---|---|
| PubChem CID | 105219793 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2,5-dimethylhept-2-en-4-ylhydrazine |
| SMILES | CCC(C)C(C=C(C)C)NN |
| InChI | InChI=1S/C9H20N2/c1-5-8(4)9(11-10)6-7(2)3/h6,8-9,11H,5,10H2,1-4H3 |
| InChIKey | HIOPVPJCZDBZIV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|