C17H21N5O2S — CID 10522473
ethyl N-[[benzyl-(2,6-dimethylpyrimidin-4-yl)amino]carbamothioyl]carbamate (PubChem CID 10522473) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is ethyl N-[[benzyl-(2,6-dimethylpyrimidin-4-yl)amino]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[benzyl-(2,6-dimethylpyrimidin-4-yl)amino]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 10522473 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl N-[[benzyl-(2,6-dimethylpyrimidin-4-yl)amino]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NN(Cc1ccccc1)c1cc(C)nc(C)n1 |
| InChI | InChI=1S/C17H21N5O2S/c1-4-24-17(23)20-16(25)21-22(11-14-8-6-5-7-9-14)15-10-12(2)18-13(3)19-15/h5-10H,4,11H2,1-3H3,(H2,20,21,23,25) |
| InChIKey | AMBTZQFLYBTDQF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|