C14H17N5S — CID 852667
1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-phenylthiourea (PubChem CID 852667) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-phenylthiourea.
| Compound Name | 1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 852667 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-phenylthiourea |
| SMILES | Cc1cc(N(C)NC(=S)Nc2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C14H17N5S/c1-10-9-13(16-11(2)15-10)19(3)18-14(20)17-12-7-5-4-6-8-12/h4-9H,1-3H3,(H2,17,18,20) |
| InChIKey | NAZCXUIEJMTFLT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|