C15H19N5OS — CID 10734275
1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-(4-methoxyphenyl)thiourea (PubChem CID 10734275) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 10734275 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NN(C)c2cc(C)nc(C)n2)cc1 |
| InChI | InChI=1S/C15H19N5OS/c1-10-9-14(17-11(2)16-10)20(3)19-15(22)18-12-5-7-13(21-4)8-6-12/h5-9H,1-4H3,(H2,18,19,22) |
| InChIKey | CNQVUAAOKGHIBO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|