C12H14N4O2S — CID 164801074
N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonohydrazide (PubChem CID 164801074) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonohydrazide.
| Compound Name | N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 164801074 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonohydrazide |
| SMILES | Cc1cc(N(N)S(=O)(=O)c2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C12H14N4O2S/c1-9-8-12(15-10(2)14-9)16(13)19(17,18)11-6-4-3-5-7-11/h3-8H,13H2,1-2H3 |
| InChIKey | CRQDHHKUSLZHTJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|