C14H17N3O2S — CID 54318786
N-(2,6-dimethylpyrimidin-4-yl)-N,3-dimethylbenzenesulfonamide (PubChem CID 54318786) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is N-(2,6-dimethylpyrimidin-4-yl)-N,3-dimethylbenzenesulfonamide.
| Compound Name | N-(2,6-dimethylpyrimidin-4-yl)-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 54318786 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-(2,6-dimethylpyrimidin-4-yl)-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(C)c2cc(C)nc(C)n2)c1 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-6-5-7-13(8-10)20(18,19)17(4)14-9-11(2)15-12(3)16-14/h5-9H,1-4H3 |
| InChIKey | SQCYSCXJWFIELX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |