C12H10Cl3N5S — CID 3032881
1-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]-3-phenylthiourea (PubChem CID 3032881) has the molecular formula C12H10Cl3N5S and a molecular weight of 362.67 g/mol. Its IUPAC name is 1-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]-3-phenylthiourea.
| Compound Name | 1-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3032881 |
| Molecular Formula | C12H10Cl3N5S |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 1-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]-3-phenylthiourea |
| SMILES | Cc1nc(NC(=S)Nc2ccccc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H10Cl3N5S/c1-7-16-9(12(13,14)15)19-10(17-7)20-11(21)18-8-5-3-2-4-6-8/h2-6H,1H3,(H2,16,17,18,19,20,21) |
| InChIKey | ZXBDGNNCKAOROX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|