C10H9N5O2S — CID 3499643
3-(phenylcarbamothioylamino)-1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 3499643) has the molecular formula C10H9N5O2S and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-(phenylcarbamothioylamino)-1H-1,2,4-triazole-5-carboxylic acid.
| Compound Name | 3-(phenylcarbamothioylamino)-1H-1,2,4-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 3499643 |
| Molecular Formula | C10H9N5O2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-(phenylcarbamothioylamino)-1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1nc(NC(=S)Nc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C10H9N5O2S/c16-8(17)7-12-9(15-14-7)13-10(18)11-6-4-2-1-3-5-6/h1-5H,(H,16,17)(H3,11,12,13,14,15,18) |
| InChIKey | WFWIKOFOIFYHNK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|