C14H24N2S2 — CID 105227750
(1-cyclohexylsulfanyl-4-thiophen-2-ylbutan-2-yl)hydrazine (PubChem CID 105227750) has the molecular formula C14H24N2S2 and a molecular weight of 284.49 g/mol. Its IUPAC name is (1-cyclohexylsulfanyl-4-thiophen-2-ylbutan-2-yl)hydrazine.
| Compound Name | (1-cyclohexylsulfanyl-4-thiophen-2-ylbutan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105227750 |
| Molecular Formula | C14H24N2S2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1-cyclohexylsulfanyl-4-thiophen-2-ylbutan-2-yl)hydrazine |
| SMILES | NNC(CCc1cccs1)CSC1CCCCC1 |
| InChI | InChI=1S/C14H24N2S2/c15-16-12(8-9-14-7-4-10-17-14)11-18-13-5-2-1-3-6-13/h4,7,10,12-13,16H,1-3,5-6,8-9,11,15H2 |
| InChIKey | ANLJBIYMEANGFA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|