C15H25NS2 — CID 65140219
1-cyclopentylsulfanyl-N-propyl-3-thiophen-2-ylpropan-2-amine (PubChem CID 65140219) has the molecular formula C15H25NS2 and a molecular weight of 283.51 g/mol. Its IUPAC name is 1-cyclopentylsulfanyl-N-propyl-3-thiophen-2-ylpropan-2-amine.
| Compound Name | 1-cyclopentylsulfanyl-N-propyl-3-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 65140219 |
| Molecular Formula | C15H25NS2 |
| Molecular Weight | 283.51 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-cyclopentylsulfanyl-N-propyl-3-thiophen-2-ylpropan-2-amine |
| SMILES | CCCNC(CSC1CCCC1)Cc1cccs1 |
| InChI | InChI=1S/C15H25NS2/c1-2-9-16-13(11-15-8-5-10-17-15)12-18-14-6-3-4-7-14/h5,8,10,13-14,16H,2-4,6-7,9,11-12H2,1H3 |
| InChIKey | GMDIFNRMYKECFI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |