C16H17FN2O2 — CID 105230157
[2,3-dihydro-1,4-benzodioxin-3-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine (PubChem CID 105230157) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is [2,3-dihydro-1,4-benzodioxin-3-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1,4-benzodioxin-3-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105230157 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [2,3-dihydro-1,4-benzodioxin-3-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine |
| SMILES | Cc1ccc(F)cc1C(NN)C1COc2ccccc2O1 |
| InChI | InChI=1S/C16H17FN2O2/c1-10-6-7-11(17)8-12(10)16(19-18)15-9-20-13-4-2-3-5-14(13)21-15/h2-8,15-16,19H,9,18H2,1H3 |
| InChIKey | ONKBVCRMWXUCSQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|