C14H14FN3O2 — CID 105230225
[2,3-dihydro-1,4-benzodioxin-3-yl-(3-fluoro-4-pyridinyl)methyl]hydrazine (PubChem CID 105230225) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is [2,3-dihydro-1,4-benzodioxin-3-yl-(3-fluoro-4-pyridinyl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1,4-benzodioxin-3-yl-(3-fluoro-4-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105230225 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [2,3-dihydro-1,4-benzodioxin-3-yl-(3-fluoro-4-pyridinyl)methyl]hydrazine |
| SMILES | NNC(c1ccncc1F)C1COc2ccccc2O1 |
| InChI | InChI=1S/C14H14FN3O2/c15-10-7-17-6-5-9(10)14(18-16)13-8-19-11-3-1-2-4-12(11)20-13/h1-7,13-14,18H,8,16H2 |
| InChIKey | LQODVVGXKNWVNF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|