C8H14F3N5 — CID 105230684
1-methyl-4-(4,4,4-trifluoro-1-hydrazinylbutyl)pyrazol-5-amine (PubChem CID 105230684) has the molecular formula C8H14F3N5 and a molecular weight of 237.23 g/mol. Its IUPAC name is 1-methyl-4-(4,4,4-trifluoro-1-hydrazinylbutyl)pyrazol-5-amine.
| Compound Name | 1-methyl-4-(4,4,4-trifluoro-1-hydrazinylbutyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 105230684 |
| Molecular Formula | C8H14F3N5 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-methyl-4-(4,4,4-trifluoro-1-hydrazinylbutyl)pyrazol-5-amine |
| SMILES | Cn1ncc(C(CCC(F)(F)F)NN)c1N |
| InChI | InChI=1S/C8H14F3N5/c1-16-7(12)5(4-14-16)6(15-13)2-3-8(9,10)11/h4,6,15H,2-3,12-13H2,1H3 |
| InChIKey | RPBOMSSJLJEHCT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|