About 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine
4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine (PubChem CID 105230921) has the molecular formula C13H25N5
and a molecular weight of 251.38 g/mol. Its IUPAC name is 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine |
| PubChem CID | 105230921 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine |
| SMILES | CC1CC(C)CC(C(NN)c2cnn(C)c2N)C1 |
| InChI | InChI=1S/C13H25N5/c1-8-4-9(2)6-10(5-8)12(17-15)11-7-16-18(3)13(11)14/h7-10,12,17H,4-6,14-15H2,1-3H3 |
| InChIKey | WBOOXBISJQJDRF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine?
The IUPAC name of 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine (CID 105230921) is 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine.
What is the SMILES notation for 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine?
The canonical SMILES for 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine is CC1CC(C)CC(C(NN)c2cnn(C)c2N)C1.
What is the InChIKey of 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine?
The InChIKey is WBOOXBISJQJDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5/c1-8-4-9(2)6-10(5-8)12(17-15)11-7-16-18(3)13(11)14/h7-10,12,17H,4-6,14-15H2,1-3H3.
What are the key properties of 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine?
4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine has a molecular weight of 251.38 g/mol, XLogP of 1.58, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethylcyclohexyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine is sourced from PubChem (CID 105230921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).