C13H18N2 — CID 105234078
[cyclopropyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine (PubChem CID 105234078) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is [cyclopropyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine.
| Compound Name | [cyclopropyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105234078 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | [cyclopropyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine |
| SMILES | NNC(C1CC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2/c14-15-13(9-5-6-9)12-7-10-3-1-2-4-11(10)8-12/h1-4,9,12-13,15H,5-8,14H2 |
| InChIKey | BUBYDKRNESRRKF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|