C15H22N2 — CID 105234225
[3-cyclopropyl-1-(2,3-dihydro-1H-inden-2-yl)propyl]hydrazine (PubChem CID 105234225) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is [3-cyclopropyl-1-(2,3-dihydro-1H-inden-2-yl)propyl]hydrazine.
| Compound Name | [3-cyclopropyl-1-(2,3-dihydro-1H-inden-2-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105234225 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [3-cyclopropyl-1-(2,3-dihydro-1H-inden-2-yl)propyl]hydrazine |
| SMILES | NNC(CCC1CC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H22N2/c16-17-15(8-7-11-5-6-11)14-9-12-3-1-2-4-13(12)10-14/h1-4,11,14-15,17H,5-10,16H2 |
| InChIKey | VYGXGHQYOALBCY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|