C17H24N2 — CID 114190759
[1-(2,3-dihydro-1H-inden-2-yl)-5,5-dimethylhex-3-ynyl]hydrazine (PubChem CID 114190759) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-2-yl)-5,5-dimethylhex-3-ynyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1H-inden-2-yl)-5,5-dimethylhex-3-ynyl]hydrazine |
|---|---|
| PubChem CID | 114190759 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-2-yl)-5,5-dimethylhex-3-ynyl]hydrazine |
| SMILES | CC(C)(C)C#CCC(NN)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H24N2/c1-17(2,3)10-6-9-16(19-18)15-11-13-7-4-5-8-14(13)12-15/h4-5,7-8,15-16,19H,9,11-12,18H2,1-3H3 |
| InChIKey | AVXOWGBRYKZDKI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|