C17H26N2 — CID 105234162
[cycloheptyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine (PubChem CID 105234162) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is [cycloheptyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine.
| Compound Name | [cycloheptyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105234162 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | [cycloheptyl(2,3-dihydro-1H-inden-2-yl)methyl]hydrazine |
| SMILES | NNC(C1CCCCCC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H26N2/c18-19-17(13-7-3-1-2-4-8-13)16-11-14-9-5-6-10-15(14)12-16/h5-6,9-10,13,16-17,19H,1-4,7-8,11-12,18H2 |
| InChIKey | UFKSMSUXOPXLGS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|