C16H22N2 — CID 105340121
[1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl(cyclobutyl)methyl]hydrazine (PubChem CID 105340121) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is [1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl(cyclobutyl)methyl]hydrazine.
| Compound Name | [1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl(cyclobutyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105340121 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | [1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl(cyclobutyl)methyl]hydrazine |
| SMILES | NNC(C1CCC1)C1C2CCc3ccccc3C21 |
| InChI | InChI=1S/C16H22N2/c17-18-16(11-5-3-6-11)15-13-9-8-10-4-1-2-7-12(10)14(13)15/h1-2,4,7,11,13-16,18H,3,5-6,8-9,17H2 |
| InChIKey | NKSXOYLSKCKFJD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|