C18H22N2S — CID 105308886
[1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-thiophen-2-ylpropyl]hydrazine (PubChem CID 105308886) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is [1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-thiophen-2-ylpropyl]hydrazine.
| Compound Name | [1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-thiophen-2-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 105308886 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-thiophen-2-ylpropyl]hydrazine |
| SMILES | NNC(CCc1cccs1)C1C2CCc3ccccc3C21 |
| InChI | InChI=1S/C18H22N2S/c19-20-16(10-8-13-5-3-11-21-13)18-15-9-7-12-4-1-2-6-14(12)17(15)18/h1-6,11,15-18,20H,7-10,19H2 |
| InChIKey | IXRCTSARIIZPGW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|