C17H22N4 — CID 105291138
[1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine (PubChem CID 105291138) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is [1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105291138 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine |
| SMILES | Cn1cc(CC(NN)C2C3CCc4ccccc4C32)cn1 |
| InChI | InChI=1S/C17H22N4/c1-21-10-11(9-19-21)8-15(20-18)17-14-7-6-12-4-2-3-5-13(12)16(14)17/h2-5,9-10,14-17,20H,6-8,18H2,1H3 |
| InChIKey | QOOLVFZHGZATDL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|