C18H21N3 — CID 105320552
[1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl-(4-methyl-3-pyridinyl)methyl]hydrazine (PubChem CID 105320552) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is [1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl-(4-methyl-3-pyridinyl)methyl]hydrazine.
| Compound Name | [1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl-(4-methyl-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105320552 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | [1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl-(4-methyl-3-pyridinyl)methyl]hydrazine |
| SMILES | Cc1ccncc1C(NN)C1C2CCc3ccccc3C21 |
| InChI | InChI=1S/C18H21N3/c1-11-8-9-20-10-15(11)18(21-19)17-14-7-6-12-4-2-3-5-13(12)16(14)17/h2-5,8-10,14,16-18,21H,6-7,19H2,1H3 |
| InChIKey | JEQLZOKUKDSMPI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|