C13H21FN2O2S2 — CID 105236139
[5-ethylsulfonyl-1-(2-fluorophenyl)sulfanylpentan-2-yl]hydrazine (PubChem CID 105236139) has the molecular formula C13H21FN2O2S2 and a molecular weight of 320.45 g/mol. Its IUPAC name is [5-ethylsulfonyl-1-(2-fluorophenyl)sulfanylpentan-2-yl]hydrazine.
| Compound Name | [5-ethylsulfonyl-1-(2-fluorophenyl)sulfanylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105236139 |
| Molecular Formula | C13H21FN2O2S2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [5-ethylsulfonyl-1-(2-fluorophenyl)sulfanylpentan-2-yl]hydrazine |
| SMILES | CCS(=O)(=O)CCCC(CSc1ccccc1F)NN |
| InChI | InChI=1S/C13H21FN2O2S2/c1-2-20(17,18)9-5-6-11(16-15)10-19-13-8-4-3-7-12(13)14/h3-4,7-8,11,16H,2,5-6,9-10,15H2,1H3 |
| InChIKey | BROPGEZRFJXDBI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|