C17H21N2+ — CID 10523796
N,N,2-trimethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline (PubChem CID 10523796) has the molecular formula C17H21N2+ and a molecular weight of 253.37 g/mol. Its IUPAC name is N,N,2-trimethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline.
| Compound Name | N,N,2-trimethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 10523796 |
| Molecular Formula | C17H21N2+ |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N,N,2-trimethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline |
| SMILES | Cc1cc(/C=C/c2cccc[n+]2C)ccc1N(C)C |
| InChI | InChI=1S/C17H21N2/c1-14-13-15(9-11-17(14)18(2)3)8-10-16-7-5-6-12-19(16)4/h5-13H,1-4H3/q+1 |
| InChIKey | ISQDDJCTCSNILX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|