C17H11BrCl2O — CID 10523931
3-bromo-4-(2,5-dichlorophenyl)-2-methylnaphthalen-1-ol (PubChem CID 10523931) has the molecular formula C17H11BrCl2O and a molecular weight of 382.08 g/mol. Its IUPAC name is 3-bromo-4-(2,5-dichlorophenyl)-2-methylnaphthalen-1-ol.
| Compound Name | 3-bromo-4-(2,5-dichlorophenyl)-2-methylnaphthalen-1-ol |
|---|---|
| PubChem CID | 10523931 |
| Molecular Formula | C17H11BrCl2O |
| Molecular Weight | 382.08 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 3-bromo-4-(2,5-dichlorophenyl)-2-methylnaphthalen-1-ol |
| SMILES | Cc1c(Br)c(-c2cc(Cl)ccc2Cl)c2ccccc2c1O |
| InChI | InChI=1S/C17H11BrCl2O/c1-9-16(18)15(13-8-10(19)6-7-14(13)20)11-4-2-3-5-12(11)17(9)21/h2-8,21H,1H3 |
| InChIKey | CBTPNVIPRULTEY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.08 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |