C17H12Cl4 — CID 70540354
1,4-dichloro-2-methylbenzene;1,4-dichloronaphthalene (PubChem CID 70540354) has the molecular formula C17H12Cl4 and a molecular weight of 358.10 g/mol. Its IUPAC name is 1,4-dichloro-2-methylbenzene;1,4-dichloronaphthalene.
| Compound Name | 1,4-dichloro-2-methylbenzene;1,4-dichloronaphthalene |
|---|---|
| PubChem CID | 70540354 |
| Molecular Formula | C17H12Cl4 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 1,4-dichloro-2-methylbenzene;1,4-dichloronaphthalene |
| SMILES | Cc1cc(Cl)ccc1Cl.Clc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C10H6Cl2.C7H6Cl2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-5-4-6(8)2-3-7(5)9/h1-6H;2-4H,1H3 |
| InChIKey | MGASBUWWGGVXHU-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |