C22H26N2O4 — CID 10523965
(2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]acetonitrile (PubChem CID 10523965) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]acetonitrile.
| Compound Name | (2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 10523965 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]acetonitrile |
| SMILES | CC1(C)O[C@@H]([C@@H](C#N)N(O)Cc2ccccc2)[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C22H26N2O4/c1-22(2)27-20(16-26-15-18-11-7-4-8-12-18)21(28-22)19(13-23)24(25)14-17-9-5-3-6-10-17/h3-12,19-21,25H,14-16H2,1-2H3/t19-,20+,21+/m1/s1 |
| InChIKey | CYMQTGREVURMJK-HKBOAZHASA-N |
| XLogP | 3.51 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|