C12H25N3 — CID 105239965
(2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-yl)hydrazine (PubChem CID 105239965) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is (2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-yl)hydrazine.
| Compound Name | (2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-yl)hydrazine |
|---|---|
| PubChem CID | 105239965 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | (2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-yl)hydrazine |
| SMILES | C=C(C)C(NN)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C12H25N3/c1-10(2)11(14-13)12(3,4)15-8-6-5-7-9-15/h11,14H,1,5-9,13H2,2-4H3 |
| InChIKey | KSFAIPZMRGJVFM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|