C9H20N2 — CID 142959927
1,6-dimethyl-4-methylidenediazinane;ethane (PubChem CID 142959927) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,6-dimethyl-4-methylidenediazinane;ethane.
| Compound Name | 1,6-dimethyl-4-methylidenediazinane;ethane |
|---|---|
| PubChem CID | 142959927 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1,6-dimethyl-4-methylidenediazinane;ethane |
| SMILES | C=C1CNN(C)C(C)C1.CC |
| InChI | InChI=1S/C7H14N2.C2H6/c1-6-4-7(2)9(3)8-5-6;1-2/h7-8H,1,4-5H2,2-3H3;1-2H3 |
| InChIKey | CAKJIDPGLWQIJE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|