C8H19N3 — CID 105259365
3-hydrazinyl-N,N,4-trimethylpent-4-en-1-amine (PubChem CID 105259365) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 3-hydrazinyl-N,N,4-trimethylpent-4-en-1-amine.
| Compound Name | 3-hydrazinyl-N,N,4-trimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 105259365 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 3-hydrazinyl-N,N,4-trimethylpent-4-en-1-amine |
| SMILES | C=C(C)C(CCN(C)C)NN |
| InChI | InChI=1S/C8H19N3/c1-7(2)8(10-9)5-6-11(3)4/h8,10H,1,5-6,9H2,2-4H3 |
| InChIKey | BCDJZPAHIKZQJP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|