C11H25N3 — CID 105244061
N,N-diethyl-3-hydrazinylhept-6-en-1-amine (PubChem CID 105244061) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinylhept-6-en-1-amine.
| Compound Name | N,N-diethyl-3-hydrazinylhept-6-en-1-amine |
|---|---|
| PubChem CID | 105244061 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N,N-diethyl-3-hydrazinylhept-6-en-1-amine |
| SMILES | C=CCCC(CCN(CC)CC)NN |
| InChI | InChI=1S/C11H25N3/c1-4-7-8-11(13-12)9-10-14(5-2)6-3/h4,11,13H,1,5-10,12H2,2-3H3 |
| InChIKey | WIEGNYBQZGUYCF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|