C10H23N3 — CID 105244122
N,N-diethyl-3-hydrazinylhex-5-en-1-amine (PubChem CID 105244122) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinylhex-5-en-1-amine.
| Compound Name | N,N-diethyl-3-hydrazinylhex-5-en-1-amine |
|---|---|
| PubChem CID | 105244122 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | N,N-diethyl-3-hydrazinylhex-5-en-1-amine |
| SMILES | C=CCC(CCN(CC)CC)NN |
| InChI | InChI=1S/C10H23N3/c1-4-7-10(12-11)8-9-13(5-2)6-3/h4,10,12H,1,5-9,11H2,2-3H3 |
| InChIKey | MVYSSQLYFGTHBE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|