C11H13NNa2O7S2 — CID 10524014
disodium;4-[(Z)-[tert-butyl(oxido)azaniumylidene](114C)methyl]benzene-1,3-disulfonate (PubChem CID 10524014) has the molecular formula C11H13NNa2O7S2 and a molecular weight of 383.33 g/mol. Its IUPAC name is disodium;4-[(Z)-[tert-butyl(oxido)azaniumylidene](114C)methyl]benzene-1,3-disulfonate.
| Compound Name | disodium;4-[(Z)-[tert-butyl(oxido)azaniumylidene](114C)methyl]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 10524014 |
| Molecular Formula | C11H13NNa2O7S2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | disodium;4-[(Z)-[tert-butyl(oxido)azaniumylidene](114C)methyl]benzene-1,3-disulfonate |
| SMILES | CC(C)(C)/[N+]([O-])=[14CH]/c1ccc(S(=O)(=O)[O-])cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H15NO7S2.2Na/c1-11(2,3)12(13)7-8-4-5-9(20(14,15)16)6-10(8)21(17,18)19;;/h4-7H,1-3H3,(H,14,15,16)(H,17,18,19);;/q;2*+1/p-2/b12-7-;;/i7+2;; |
| InChIKey | XLZOVRYBVCMCGL-CRNBSWOBSA-L |
| XLogP | -5.77 |
| TPSA | 140.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|