C15H27N3O2 — CID 105240484
1-(3,4-dimethoxyphenyl)-1-hydrazinyl-N,N,2-trimethylbutan-2-amine (PubChem CID 105240484) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-1-hydrazinyl-N,N,2-trimethylbutan-2-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-1-hydrazinyl-N,N,2-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 105240484 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-1-hydrazinyl-N,N,2-trimethylbutan-2-amine |
| SMILES | CCC(C)(C(NN)c1ccc(OC)c(OC)c1)N(C)C |
| InChI | InChI=1S/C15H27N3O2/c1-7-15(2,18(3)4)14(17-16)11-8-9-12(19-5)13(10-11)20-6/h8-10,14,17H,7,16H2,1-6H3 |
| InChIKey | CFXZUYMBFCKEKV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|