C14H24N2O2 — CID 116934449
1-(3,4-dimethoxyphenyl)-2,2-dimethylbutane-1,4-diamine (PubChem CID 116934449) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2,2-dimethylbutane-1,4-diamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934449 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2,2-dimethylbutane-1,4-diamine |
| SMILES | COc1ccc(C(N)C(C)(C)CCN)cc1OC |
| InChI | InChI=1S/C14H24N2O2/c1-14(2,7-8-15)13(16)10-5-6-11(17-3)12(9-10)18-4/h5-6,9,13H,7-8,15-16H2,1-4H3 |
| InChIKey | BUMVHRVBWTYQHX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |