C11H25N3 — CID 105240732
4-hydrazinyl-N,N,3,6-tetramethylhept-5-en-3-amine (PubChem CID 105240732) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-hydrazinyl-N,N,3,6-tetramethylhept-5-en-3-amine.
| Compound Name | 4-hydrazinyl-N,N,3,6-tetramethylhept-5-en-3-amine |
|---|---|
| PubChem CID | 105240732 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 4-hydrazinyl-N,N,3,6-tetramethylhept-5-en-3-amine |
| SMILES | CCC(C)(C(C=C(C)C)NN)N(C)C |
| InChI | InChI=1S/C11H25N3/c1-7-11(4,14(5)6)10(13-12)8-9(2)3/h8,10,13H,7,12H2,1-6H3 |
| InChIKey | VZGOKGINXUNYCW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|