C15H28ClN5 — CID 105241224
[1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutyl]hydrazine (PubChem CID 105241224) has the molecular formula C15H28ClN5 and a molecular weight of 313.88 g/mol. Its IUPAC name is [1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutyl]hydrazine.
| Compound Name | [1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutyl]hydrazine |
|---|---|
| PubChem CID | 105241224 |
| Molecular Formula | C15H28ClN5 |
| Molecular Weight | 313.88 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | [1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutyl]hydrazine |
| SMILES | CCC(C)(C(NN)c1c(Cl)cnn1C(C)C)N1CCCC1 |
| InChI | InChI=1S/C15H28ClN5/c1-5-15(4,20-8-6-7-9-20)14(19-17)13-12(16)10-18-21(13)11(2)3/h10-11,14,19H,5-9,17H2,1-4H3 |
| InChIKey | JVPATUDGGQHCBO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.88 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|