C15H29N5S — CID 105247183
[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine (PubChem CID 105247183) has the molecular formula C15H29N5S and a molecular weight of 311.50 g/mol. Its IUPAC name is [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105247183 |
| Molecular Formula | C15H29N5S |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine |
| SMILES | CN1CCN(C)C(C(Cc2nc(C(C)(C)C)cs2)NN)C1 |
| InChI | InChI=1S/C15H29N5S/c1-15(2,3)13-10-21-14(17-13)8-11(18-16)12-9-19(4)6-7-20(12)5/h10-12,18H,6-9,16H2,1-5H3 |
| InChIKey | RTBRFLSMIOUZRW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|