C14H22ClN3O2 — CID 105247506
[(4-chloro-3-methoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine (PubChem CID 105247506) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is [(4-chloro-3-methoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine.
| Compound Name | [(4-chloro-3-methoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247506 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(4-chloro-3-methoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine |
| SMILES | CCN1CCOC(C(NN)c2ccc(Cl)c(OC)c2)C1 |
| InChI | InChI=1S/C14H22ClN3O2/c1-3-18-6-7-20-13(9-18)14(17-16)10-4-5-11(15)12(8-10)19-2/h4-5,8,13-14,17H,3,6-7,9,16H2,1-2H3 |
| InChIKey | MFDRCYGRXQMIHP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|