C14H24N4O2 — CID 105247594
[(5-ethoxy-3-pyridinyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine (PubChem CID 105247594) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [(5-ethoxy-3-pyridinyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine.
| Compound Name | [(5-ethoxy-3-pyridinyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247594 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [(5-ethoxy-3-pyridinyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine |
| SMILES | CCOc1cncc(C(NN)C2CN(CC)CCO2)c1 |
| InChI | InChI=1S/C14H24N4O2/c1-3-18-5-6-20-13(10-18)14(17-15)11-7-12(19-4-2)9-16-8-11/h7-9,13-14,17H,3-6,10,15H2,1-2H3 |
| InChIKey | OGDOFXSWEMHDEI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|