C15H25N3O3 — CID 105247678
[(3,5-dimethoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine (PubChem CID 105247678) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is [(3,5-dimethoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine.
| Compound Name | [(3,5-dimethoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247678 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [(3,5-dimethoxyphenyl)-(4-ethylmorpholin-2-yl)methyl]hydrazine |
| SMILES | CCN1CCOC(C(NN)c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-4-18-5-6-21-14(10-18)15(17-16)11-7-12(19-2)9-13(8-11)20-3/h7-9,14-15,17H,4-6,10,16H2,1-3H3 |
| InChIKey | FTRYNNLJUWPMSX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|