C13H23ClN6O — CID 105249908
[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine (PubChem CID 105249908) has the molecular formula C13H23ClN6O and a molecular weight of 314.82 g/mol. Its IUPAC name is [[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine.
| Compound Name | [[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249908 |
| Molecular Formula | C13H23ClN6O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-diazabicyclo[2.2.2]octan-2-yl)methyl]hydrazine |
| SMILES | COCCn1ncc(Cl)c1C(NN)C1CN2CCN1CC2 |
| InChI | InChI=1S/C13H23ClN6O/c1-21-7-6-20-13(10(14)8-16-20)12(17-15)11-9-18-2-4-19(11)5-3-18/h8,11-12,17H,2-7,9,15H2,1H3 |
| InChIKey | AFFKRPWWBWBWHR-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|