C19H21N3O2Se — CID 10525132
ethyl (4S,5R)-5-azido-5-phenyl-4-phenylselanylpentanoate (PubChem CID 10525132) has the molecular formula C19H21N3O2Se and a molecular weight of 402.36 g/mol. Its IUPAC name is ethyl (4S,5R)-5-azido-5-phenyl-4-phenylselanylpentanoate.
| Compound Name | ethyl (4S,5R)-5-azido-5-phenyl-4-phenylselanylpentanoate |
|---|---|
| PubChem CID | 10525132 |
| Molecular Formula | C19H21N3O2Se |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | ethyl (4S,5R)-5-azido-5-phenyl-4-phenylselanylpentanoate |
| SMILES | CCOC(=O)CC[C@H]([Se]c1ccccc1)[C@H](N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2Se/c1-2-24-18(23)14-13-17(25-16-11-7-4-8-12-16)19(21-22-20)15-9-5-3-6-10-15/h3-12,17,19H,2,13-14H2,1H3/t17-,19+/m0/s1 |
| InChIKey | SPMUOGBWKNRFTF-PKOBYXMFSA-N |
| XLogP | 4.20 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|