C27H28N2O4 — CID 137288420
ethyl (4S,5S)-4,5-bis[(2-hydroxyphenyl)methylideneamino]-5-phenylpentanoate (PubChem CID 137288420) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl (4S,5S)-4,5-bis[(2-hydroxyphenyl)methylideneamino]-5-phenylpentanoate.
| Compound Name | ethyl (4S,5S)-4,5-bis[(2-hydroxyphenyl)methylideneamino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 137288420 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | ethyl (4S,5S)-4,5-bis[(2-hydroxyphenyl)methylideneamino]-5-phenylpentanoate |
| SMILES | CCOC(=O)CC[C@H](/N=C/c1ccccc1O)[C@@H](/N=C/c1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c1-2-33-26(32)17-16-23(28-18-21-12-6-8-14-24(21)30)27(20-10-4-3-5-11-20)29-19-22-13-7-9-15-25(22)31/h3-15,18-19,23,27,30-31H,2,16-17H2,1H3/b28-18+,29-19+/t23-,27-/m0/s1 |
| InChIKey | JAYUNMXHBXAMIF-NJGJWALLSA-N |
| XLogP | 5.09 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|