C12H17ClN6 — CID 105252827
[1-(2-chloro-4-pyridinyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105252827) has the molecular formula C12H17ClN6 and a molecular weight of 280.76 g/mol. Its IUPAC name is [1-(2-chloro-4-pyridinyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2-chloro-4-pyridinyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105252827 |
| Molecular Formula | C12H17ClN6 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [1-(2-chloro-4-pyridinyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CC(C)n1ncnc1CC(NN)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN6/c1-8(2)19-12(16-7-17-19)6-10(18-14)9-3-4-15-11(13)5-9/h3-5,7-8,10,18H,6,14H2,1-2H3 |
| InChIKey | YVEZFBVTGWQCLA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|