C11H16ClN5O — CID 106694528
[1-(5-chlorofuran-2-yl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 106694528) has the molecular formula C11H16ClN5O and a molecular weight of 269.74 g/mol. Its IUPAC name is [1-(5-chlorofuran-2-yl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(5-chlorofuran-2-yl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106694528 |
| Molecular Formula | C11H16ClN5O |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [1-(5-chlorofuran-2-yl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CC(C)n1ncnc1CC(NN)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H16ClN5O/c1-7(2)17-11(14-6-15-17)5-8(16-13)9-3-4-10(12)18-9/h3-4,6-8,16H,5,13H2,1-2H3 |
| InChIKey | NFLFXVYFNZTIMX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|